Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Benzyl acrylate, 98%, stab. with ca 150ppm 4-methoxyphenol
CAS: 2495-35-4 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.19 MDL Number: MFCD00048147 InChI Key: GCTPMLUUWLLESL-UHFFFAOYSA-N Synonym: benzyl acrylate,benzylacrylate,2-propenoic acid, phenylmethyl ester,sartomer sr 432,acrylic acid, benzyl ester,acrylic acid benzyl ester,phenylmethyl prop-2-enoate,benzyl 2-propenoate,fancryl fa-bza,acrylic acid benzyl PubChem CID: 75617 IUPAC Name: benzyl prop-2-enoate SMILES: C=CC(=O)OCC1=CC=CC=C1
| PubChem CID | 75617 |
|---|---|
| CAS | 2495-35-4 |
| Molecular Weight (g/mol) | 162.19 |
| MDL Number | MFCD00048147 |
| SMILES | C=CC(=O)OCC1=CC=CC=C1 |
| Synonym | benzyl acrylate,benzylacrylate,2-propenoic acid, phenylmethyl ester,sartomer sr 432,acrylic acid, benzyl ester,acrylic acid benzyl ester,phenylmethyl prop-2-enoate,benzyl 2-propenoate,fancryl fa-bza,acrylic acid benzyl |
| IUPAC Name | benzyl prop-2-enoate |
| InChI Key | GCTPMLUUWLLESL-UHFFFAOYSA-N |
| Molecular Formula | C10H10O2 |
1,1,1,3,3,3-Hexafluoroisopropyl acrylate, 98+%, stab. with 50ppm 4-methoxyphenol
CAS: 2160-89-6 Molecular Formula: C6H4F6O2 Molecular Weight (g/mol): 222.09 MDL Number: MFCD00040104 InChI Key: MNSWITGNWZSAMC-UHFFFAOYSA-N Synonym: 1,1,1,3,3,3-hexafluoroisopropyl acrylate,hexafluoroisopropyl acrylate,1,1,1,3,3,3-hexafluoropropan-2-yl acrylate,2-propenoic acid, 2,2,2-trifluoro-1-trifluoromethyl ethyl ester,acrylic acid 1,1,1,3,3,3-hexafluoroisopropyl ester,hexafluoro-2-propyl acrylate,mnswitgnwzsamc-uhfffaoysa,1h-1-trifluoromethyl trifluoroethyl acrylate PubChem CID: 75096 IUPAC Name: 1,1,1,3,3,3-hexafluoropropan-2-yl prop-2-enoate SMILES: FC(F)(F)C(OC(=O)C=C)C(F)(F)F
| PubChem CID | 75096 |
|---|---|
| CAS | 2160-89-6 |
| Molecular Weight (g/mol) | 222.09 |
| MDL Number | MFCD00040104 |
| SMILES | FC(F)(F)C(OC(=O)C=C)C(F)(F)F |
| Synonym | 1,1,1,3,3,3-hexafluoroisopropyl acrylate,hexafluoroisopropyl acrylate,1,1,1,3,3,3-hexafluoropropan-2-yl acrylate,2-propenoic acid, 2,2,2-trifluoro-1-trifluoromethyl ethyl ester,acrylic acid 1,1,1,3,3,3-hexafluoroisopropyl ester,hexafluoro-2-propyl acrylate,mnswitgnwzsamc-uhfffaoysa,1h-1-trifluoromethyl trifluoroethyl acrylate |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl prop-2-enoate |
| InChI Key | MNSWITGNWZSAMC-UHFFFAOYSA-N |
| Molecular Formula | C6H4F6O2 |
2-Methoxyethyl acrylate, 98%, stab. with ca 50-100ppm 4-methoxyphenol
CAS: 3121-61-7 Molecular Formula: C6H10O3 Molecular Weight (g/mol): 130.14 MDL Number: MFCD00048149,MFCD00803685 InChI Key: HFCUBKYHMMPGBY-UHFFFAOYSA-N Synonym: 2-methoxyethyl acrylate,methoxyethyl acrylate,2-methoxyethoxy acrylate,2-propenoic acid, 2-methoxyethyl ester,methyl cellosolve acrylate,2-methoxyethanol, acrylate,ethylene glycol monomethyl ether acrylate,acrylic acid, 2-methoxyethyl ester,ethylene glycol methyl ether acrylate,sipomer mca PubChem CID: 18392 IUPAC Name: 2-methoxyethyl prop-2-enoate SMILES: COCCOC(=O)C=C
| PubChem CID | 18392 |
|---|---|
| CAS | 3121-61-7 |
| Molecular Weight (g/mol) | 130.14 |
| MDL Number | MFCD00048149,MFCD00803685 |
| SMILES | COCCOC(=O)C=C |
| Synonym | 2-methoxyethyl acrylate,methoxyethyl acrylate,2-methoxyethoxy acrylate,2-propenoic acid, 2-methoxyethyl ester,methyl cellosolve acrylate,2-methoxyethanol, acrylate,ethylene glycol monomethyl ether acrylate,acrylic acid, 2-methoxyethyl ester,ethylene glycol methyl ether acrylate,sipomer mca |
| IUPAC Name | 2-methoxyethyl prop-2-enoate |
| InChI Key | HFCUBKYHMMPGBY-UHFFFAOYSA-N |
| Molecular Formula | C6H10O3 |
3-(Phenylsulfonyl)propionitrile, 99%
CAS: 10154-75-3 Molecular Formula: C9H9NO2S Molecular Weight (g/mol): 195.236 MDL Number: MFCD00047798 InChI Key: OVZPZPVSUAKTCM-UHFFFAOYSA-N Synonym: 3-phenylsulfonyl propionitrile,3-phenylsulfonyl propanenitrile,3-phenylsulphonyl propiononitrile,3-benzenesulfonyl propanenitrile,3-phenylsulfonylpropionitrile,acmc-1bvrh,enamine_005271,3-phenylsulfonyl propanitrile,3-phenylsulphonyl-propionitrile,propanenitrile, 3-phenylsulfonyl PubChem CID: 82413 IUPAC Name: 3-(benzenesulfonyl)propanenitrile SMILES: C1=CC=C(C=C1)S(=O)(=O)CCC#N
| PubChem CID | 82413 |
|---|---|
| CAS | 10154-75-3 |
| Molecular Weight (g/mol) | 195.236 |
| MDL Number | MFCD00047798 |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCC#N |
| Synonym | 3-phenylsulfonyl propionitrile,3-phenylsulfonyl propanenitrile,3-phenylsulphonyl propiononitrile,3-benzenesulfonyl propanenitrile,3-phenylsulfonylpropionitrile,acmc-1bvrh,enamine_005271,3-phenylsulfonyl propanitrile,3-phenylsulphonyl-propionitrile,propanenitrile, 3-phenylsulfonyl |
| IUPAC Name | 3-(benzenesulfonyl)propanenitrile |
| InChI Key | OVZPZPVSUAKTCM-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO2S |
4-(Ethylsulfonyl)benzeneboronic acid, 98+%
CAS: 352530-24-6 Molecular Formula: C8H11BO4S Molecular Weight (g/mol): 214.042 MDL Number: MFCD02093076 InChI Key: CVBNDDGEVPNUNA-UHFFFAOYSA-N Synonym: 4-ethylsulfonyl phenylboronic acid,4-ethylsulfonyl phenyl boronic acid,4-ethanesulfonyl benzeneboronic acid,4-ethanesulfonyl phenylboronic acid,4-ethylsulfonylphenyl boronic acid,4-ethylsulphonyl benzeneboronic acid,boronic acid, 4-ethylsulfonyl phenyl,4-ethanesulfonyl phenyl boranediol,4-ethanesulphonyl benzeneboronic acid PubChem CID: 2773420 IUPAC Name: (4-ethylsulfonylphenyl)boronic acid SMILES: B(C1=CC=C(C=C1)S(=O)(=O)CC)(O)O
| PubChem CID | 2773420 |
|---|---|
| CAS | 352530-24-6 |
| Molecular Weight (g/mol) | 214.042 |
| MDL Number | MFCD02093076 |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)CC)(O)O |
| Synonym | 4-ethylsulfonyl phenylboronic acid,4-ethylsulfonyl phenyl boronic acid,4-ethanesulfonyl benzeneboronic acid,4-ethanesulfonyl phenylboronic acid,4-ethylsulfonylphenyl boronic acid,4-ethylsulphonyl benzeneboronic acid,boronic acid, 4-ethylsulfonyl phenyl,4-ethanesulfonyl phenyl boranediol,4-ethanesulphonyl benzeneboronic acid |
| IUPAC Name | (4-ethylsulfonylphenyl)boronic acid |
| InChI Key | CVBNDDGEVPNUNA-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO4S |
3,3'-Diaminodiphenyl sulfone, 98%
CAS: 599-61-1 Molecular Formula: C12H12N2O2S Molecular Weight (g/mol): 248.30 MDL Number: MFCD00007792 InChI Key: LJGHYPLBDBRCRZ-UHFFFAOYSA-N Synonym: 3,3'-sulfonyldianiline,3,3'-diaminodiphenyl sulfone,3-aminophenyl sulfone,benzenamine, 3,3'-sulfonylbis,3,3'-sulphonyldianiline,bis m-aminophenyl sulfone,3-aminophenyl-sulfone,3,3'-diaminophenyl sulfone,3,3'-sulfonylbis aniline,sulfone, bis m-aminophenyl PubChem CID: 11741 IUPAC Name: 3-(3-aminophenyl)sulfonylaniline SMILES: NC1=CC(=CC=C1)S(=O)(=O)C1=CC(N)=CC=C1
| PubChem CID | 11741 |
|---|---|
| CAS | 599-61-1 |
| Molecular Weight (g/mol) | 248.30 |
| MDL Number | MFCD00007792 |
| SMILES | NC1=CC(=CC=C1)S(=O)(=O)C1=CC(N)=CC=C1 |
| Synonym | 3,3'-sulfonyldianiline,3,3'-diaminodiphenyl sulfone,3-aminophenyl sulfone,benzenamine, 3,3'-sulfonylbis,3,3'-sulphonyldianiline,bis m-aminophenyl sulfone,3-aminophenyl-sulfone,3,3'-diaminophenyl sulfone,3,3'-sulfonylbis aniline,sulfone, bis m-aminophenyl |
| IUPAC Name | 3-(3-aminophenyl)sulfonylaniline |
| InChI Key | LJGHYPLBDBRCRZ-UHFFFAOYSA-N |
| Molecular Formula | C12H12N2O2S |
Phenyl vinyl sulfone, 98%
CAS: 5535-48-8 Molecular Formula: C8H8O2S Molecular Weight (g/mol): 168.21 MDL Number: MFCD00007554 InChI Key: UJTPZISIAWDGFF-UHFFFAOYSA-N Synonym: phenyl vinyl sulfone,vinylsulfonyl benzene,ethenesulfonyl benzene,benzene, ethenylsulfonyl,sulfone, phenyl vinyl,vinylsulfonylbenzene,phenyl vinyl sulphone,ethenylsulfonyl benzene,ethenesulfonyl-benzene,phenyl-vinylsulfon PubChem CID: 79664 IUPAC Name: ethenylsulfonylbenzene SMILES: C=CS(=O)(=O)C1=CC=CC=C1
| PubChem CID | 79664 |
|---|---|
| CAS | 5535-48-8 |
| Molecular Weight (g/mol) | 168.21 |
| MDL Number | MFCD00007554 |
| SMILES | C=CS(=O)(=O)C1=CC=CC=C1 |
| Synonym | phenyl vinyl sulfone,vinylsulfonyl benzene,ethenesulfonyl benzene,benzene, ethenylsulfonyl,sulfone, phenyl vinyl,vinylsulfonylbenzene,phenyl vinyl sulphone,ethenylsulfonyl benzene,ethenesulfonyl-benzene,phenyl-vinylsulfon |
| IUPAC Name | ethenylsulfonylbenzene |
| InChI Key | UJTPZISIAWDGFF-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2S |
Carbon yarn, woven from 0.076mm (0.003in) dia fibers, Thermo Scientific Chemicals
MDL Number: MFCD00133992
| MDL Number | MFCD00133992 |
|---|
6-Aminopenicillanic acid, 96%
CAS: 551-16-6 Molecular Formula: C8H12N2O3S Molecular Weight (g/mol): 216.26 MDL Number: MFCD00005176 InChI Key: NGHVIOIJCVXTGV-ALEPSDHESA-N Synonym: 6-aminopenicillanic acid,6-apa,penicin,penin,aminopenicillanic acid,6-aps,phenacyl 6-aminopenicillinate,6-aminopenicillamine acid,6-aminopenicillanate,2s,5r,6r-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo 3.2.0 heptane-2-carboxylic acid PubChem CID: 11082 ChEBI: CHEBI:16705 IUPAC Name: (2S,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid SMILES: CC1(C)S[C@@H]2[C@H](N)C(=O)N2[C@H]1C(O)=O
| PubChem CID | 11082 |
|---|---|
| CAS | 551-16-6 |
| Molecular Weight (g/mol) | 216.26 |
| ChEBI | CHEBI:16705 |
| MDL Number | MFCD00005176 |
| SMILES | CC1(C)S[C@@H]2[C@H](N)C(=O)N2[C@H]1C(O)=O |
| Synonym | 6-aminopenicillanic acid,6-apa,penicin,penin,aminopenicillanic acid,6-aps,phenacyl 6-aminopenicillinate,6-aminopenicillamine acid,6-aminopenicillanate,2s,5r,6r-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo 3.2.0 heptane-2-carboxylic acid |
| IUPAC Name | (2S,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChI Key | NGHVIOIJCVXTGV-ALEPSDHESA-N |
| Molecular Formula | C8H12N2O3S |
4-Methoxy-3-pyridineboronic acid hydrate, 97%
CAS: 1266615-79-5 Molecular Formula: C6H8BNO3 Molecular Weight (g/mol): 152.94 MDL Number: MFCD07186213 InChI Key: YUTPAZKVEOJQCY-UHFFFAOYSA-N Synonym: 4-methoxy-3-pyridineboronic acid,4-methoxypyridin-3-yl boronic acid,4-methoxypyridine-3-boronic acid,3-borono-4-methoxypyridine,4-methoxy-3-pyridylboronic acid,boronic acid, 4-methoxy-3-pyridinyl,4-methoxy-pyridine-3-boric acid,acmc-209iha,4-methoxy-5-pyridineboronic acid,4-methoxy-pyridin-3-boronic acid PubChem CID: 2762556 IUPAC Name: (4-methoxypyridin-3-yl)boronic acid SMILES: COC1=CC=NC=C1B(O)O
| PubChem CID | 2762556 |
|---|---|
| CAS | 1266615-79-5 |
| Molecular Weight (g/mol) | 152.94 |
| MDL Number | MFCD07186213 |
| SMILES | COC1=CC=NC=C1B(O)O |
| Synonym | 4-methoxy-3-pyridineboronic acid,4-methoxypyridin-3-yl boronic acid,4-methoxypyridine-3-boronic acid,3-borono-4-methoxypyridine,4-methoxy-3-pyridylboronic acid,boronic acid, 4-methoxy-3-pyridinyl,4-methoxy-pyridine-3-boric acid,acmc-209iha,4-methoxy-5-pyridineboronic acid,4-methoxy-pyridin-3-boronic acid |
| IUPAC Name | (4-methoxypyridin-3-yl)boronic acid |
| InChI Key | YUTPAZKVEOJQCY-UHFFFAOYSA-N |
| Molecular Formula | C6H8BNO3 |
Ethyl 2-oxocyclopentylacetate, 95%
CAS: 20826-94-2 Molecular Formula: C9H14O3 Molecular Weight (g/mol): 170.21 MDL Number: MFCD00044715 InChI Key: PJMKFKUFBDXYEC-SSDOTTSWSA-N Synonym: ethyl 2-oxocyclopentylacetate,ethyl 2-2-oxocyclopentyl acetate,ethyl 2-oxocyclopentaneacetate,ethyl 2-oxocyclopentyl acetate,2-oxocyclopentaneacetic acid ethyl ester,cyclopentaneacetic acid, 2-oxo-, ethyl ester,pubchem23864,ksc201q9p,ethyl 2-oxo-cyclopentyl acetate,ehtyl 2-2-oxocyclopentyl acetate PubChem CID: 2723663 IUPAC Name: ethyl 2-(2-oxocyclopentyl)acetate SMILES: CCOC(=O)C[C@H]1CCCC1=O
| PubChem CID | 2723663 |
|---|---|
| CAS | 20826-94-2 |
| Molecular Weight (g/mol) | 170.21 |
| MDL Number | MFCD00044715 |
| SMILES | CCOC(=O)C[C@H]1CCCC1=O |
| Synonym | ethyl 2-oxocyclopentylacetate,ethyl 2-2-oxocyclopentyl acetate,ethyl 2-oxocyclopentaneacetate,ethyl 2-oxocyclopentyl acetate,2-oxocyclopentaneacetic acid ethyl ester,cyclopentaneacetic acid, 2-oxo-, ethyl ester,pubchem23864,ksc201q9p,ethyl 2-oxo-cyclopentyl acetate,ehtyl 2-2-oxocyclopentyl acetate |
| IUPAC Name | ethyl 2-(2-oxocyclopentyl)acetate |
| InChI Key | PJMKFKUFBDXYEC-SSDOTTSWSA-N |
| Molecular Formula | C9H14O3 |
7-Iodo-3,4-dihydro-2H-1,5-benzodioxepine, 97%, Thermo Scientific™
CAS: 306934-90-7 Molecular Formula: C9H9IO2 Molecular Weight (g/mol): 276.073 MDL Number: MFCD02677706 InChI Key: CIZHAPZOOAJDCN-UHFFFAOYSA-N Synonym: 7-iodo-3,4-dihydro-2h-benzo b 1,4 dioxepine,2h-1,5-benzodioxepin,3,4-dihydro-7-iodo PubChem CID: 2776396 IUPAC Name: 7-iodo-3,4-dihydro-2H-1,5-benzodioxepine SMILES: C1COC2=C(C=C(C=C2)I)OC1
| PubChem CID | 2776396 |
|---|---|
| CAS | 306934-90-7 |
| Molecular Weight (g/mol) | 276.073 |
| MDL Number | MFCD02677706 |
| SMILES | C1COC2=C(C=C(C=C2)I)OC1 |
| Synonym | 7-iodo-3,4-dihydro-2h-benzo b 1,4 dioxepine,2h-1,5-benzodioxepin,3,4-dihydro-7-iodo |
| IUPAC Name | 7-iodo-3,4-dihydro-2H-1,5-benzodioxepine |
| InChI Key | CIZHAPZOOAJDCN-UHFFFAOYSA-N |
| Molecular Formula | C9H9IO2 |
2-Methoxypyridine-3-boronic acid, 97%
CAS: 163105-90-6 Molecular Formula: C6H8BNO3 Molecular Weight (g/mol): 152.94 MDL Number: MFCD03411572 InChI Key: NVOLYUXUHWBCRJ-UHFFFAOYSA-N Synonym: 2-methoxypyridine-3-boronic acid,2-methoxy-3-pyridineboronic acid,2-methoxypyridin-3-yl boronic acid,2-methoxy-3-pyridylboronic acid,2-methoxypyridin-3-yl-3-boronic acid,2-methoxy-3-pyridinyl boronic acid,2-methoxy-3-pyridyl boronic acid,2-methoxy-3-pyridinyl-boronic acid,boronic acid, 2-methoxy-3-pyridinyl,boronic acid, b-2-methoxy-3-pyridinyl PubChem CID: 2762709 IUPAC Name: (2-methoxypyridin-3-yl)boronic acid SMILES: COC1=NC=CC=C1B(O)O
| PubChem CID | 2762709 |
|---|---|
| CAS | 163105-90-6 |
| Molecular Weight (g/mol) | 152.94 |
| MDL Number | MFCD03411572 |
| SMILES | COC1=NC=CC=C1B(O)O |
| Synonym | 2-methoxypyridine-3-boronic acid,2-methoxy-3-pyridineboronic acid,2-methoxypyridin-3-yl boronic acid,2-methoxy-3-pyridylboronic acid,2-methoxypyridin-3-yl-3-boronic acid,2-methoxy-3-pyridinyl boronic acid,2-methoxy-3-pyridyl boronic acid,2-methoxy-3-pyridinyl-boronic acid,boronic acid, 2-methoxy-3-pyridinyl,boronic acid, b-2-methoxy-3-pyridinyl |
| IUPAC Name | (2-methoxypyridin-3-yl)boronic acid |
| InChI Key | NVOLYUXUHWBCRJ-UHFFFAOYSA-N |
| Molecular Formula | C6H8BNO3 |
| MDL Number | MFCD00133992 |
|---|
cis-2,3-Epoxybutane, 97%
CAS: 1758-33-4 Molecular Formula: C4H8O Molecular Weight (g/mol): 72.11 MDL Number: MFCD00005128 InChI Key: PQXKWPLDPFFDJP-ZXZARUISSA-N Synonym: cis-2,3-epoxybutane,cis-2-butene oxide,cis-2,3-dimethyloxirane,oxirane, 2,3-dimethyl-, cis,cis-2-butene epoxide,cis-2-butylene oxide,butane, 2,3-epoxy-, cis,ccris 3758,2r,3s-2,3-dimethyloxirane,meso-2,3-epoxybutane PubChem CID: 92162 IUPAC Name: (2R,3S)-2,3-dimethyloxirane SMILES: C[C@H]1O[C@H]1C
| PubChem CID | 92162 |
|---|---|
| CAS | 1758-33-4 |
| Molecular Weight (g/mol) | 72.11 |
| MDL Number | MFCD00005128 |
| SMILES | C[C@H]1O[C@H]1C |
| Synonym | cis-2,3-epoxybutane,cis-2-butene oxide,cis-2,3-dimethyloxirane,oxirane, 2,3-dimethyl-, cis,cis-2-butene epoxide,cis-2-butylene oxide,butane, 2,3-epoxy-, cis,ccris 3758,2r,3s-2,3-dimethyloxirane,meso-2,3-epoxybutane |
| IUPAC Name | (2R,3S)-2,3-dimethyloxirane |
| InChI Key | PQXKWPLDPFFDJP-ZXZARUISSA-N |
| Molecular Formula | C4H8O |